ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
| Nome del prodotto |
Benzo[b]thiophene-2-carbonyl chloride |
| Nome inglese |
Benzo[b]thiophene-2-carbonyl chloride; Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
| Formula molecolare |
C9H5ClOS |
| Peso Molecolare |
196.6534 |
| InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
| Numero CAS |
39827-11-7 |
| Struttura molecolare |
![39827-11-7 Benzo[b]thiophene-2-carbonyl chloride](https://images-a.chemnet.com/suppliers/chembase/636/175636.gif)
|
| Densità |
1.41g/cm3 |
| Punto di fusione |
85℃ |
| Punto di ebollizione |
309.5°C at 760 mmHg |
| Indice di rifrazione |
1.68 |
| Punto d'infiammabilità |
141°C |
| Pressione di vapore |
0.000636mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
